C40H63NO10S — CID 118260127
tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptylsulfonyl-2-hydroxy-2-(2-methoxyethyl)undec-4-enoate (PubChem CID 118260127) has the molecular formula C40H63NO10S and a molecular weight of 750.01 g/mol. Its IUPAC name is tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptylsulfonyl-2-hydroxy-2-(2-methoxyethyl)undec-4-enoate.
| Compound Name | tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptylsulfonyl-2-hydroxy-2-(2-methoxyethyl)undec-4-enoate |
|---|---|
| PubChem CID | 118260127 |
| Molecular Formula | C40H63NO10S |
| Molecular Weight | 750.01 g/mol |
| Exact Mass | 749.42 |
| IUPAC Name | tert-butyl (E,2S,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-11-heptylsulfonyl-2-hydroxy-2-(2-methoxyethyl)undec-4-enoate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCS(=O)(=O)CCCCCCC)[C@@](O)(CCOC)C(=O)OC(C)(C)C)C(=O)OC)cc1 |
| InChI | InChI=1S/C40H63NO10S/c1-8-10-12-16-19-29-52(46,47)30-20-17-14-13-15-18-21-34(40(45,26-28-48-6)38(44)51-39(3,4)5)36(42)41-35(37(43)49-7)31-32-22-24-33(25-23-32)50-27-11-9-2/h18,21-25,34-35,45H,8,10,12-17,19-20,26-31H2,1-7H3,(H,41,42)/b21-18+/t34-,35+,40+/m1/s1 |
| InChIKey | SHFHDFGBOJTIEH-KGOCIIKBSA-N |
| XLogP | 5.91 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.01 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|