C43H65NO10 — CID 90060220
tert-butyl (E,2S,3S)-2-(2-acetyloxyethyl)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-ethoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoate (PubChem CID 90060220) has the molecular formula C43H65NO10 and a molecular weight of 755.99 g/mol. Its IUPAC name is tert-butyl (E,2S,3S)-2-(2-acetyloxyethyl)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-ethoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoate.
| Compound Name | tert-butyl (E,2S,3S)-2-(2-acetyloxyethyl)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-ethoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoate |
|---|---|
| PubChem CID | 90060220 |
| Molecular Formula | C43H65NO10 |
| Molecular Weight | 755.99 g/mol |
| Exact Mass | 755.46 |
| IUPAC Name | tert-butyl (E,2S,3S)-2-(2-acetyloxyethyl)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-ethoxy-1-oxopropan-2-yl]carbamoyl]-2-hydroxy-12-oxononadec-4-enoate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)[C@@](O)(CCOC(C)=O)C(=O)OC(C)(C)C)C(=O)OCC)cc1 |
| InChI | InChI=1S/C43H65NO10/c1-8-11-13-16-19-22-35(46)23-20-17-14-15-18-21-24-37(43(50,29-31-52-33(4)45)41(49)54-42(5,6)7)39(47)44-38(40(48)51-10-3)32-34-25-27-36(28-26-34)53-30-12-9-2/h21,24-28,37-38,50H,8,10-11,13-20,22-23,29-32H2,1-7H3,(H,44,47)/b24-21+/t37-,38+,43+/m1/s1 |
| InChIKey | OECMHPHCKXZYTN-OAZULZPHSA-N |
| XLogP | 7.15 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.99 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|