C32H44N2O9 — CID 6320792
(2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-(4-cyanophenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 6320792) has the molecular formula C32H44N2O9 and a molecular weight of 600.71 g/mol. Its IUPAC name is (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-(4-cyanophenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-(4-cyanophenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 6320792 |
| Molecular Formula | C32H44N2O9 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-(4-cyanophenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(C#N)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C32H44N2O9/c1-2-3-4-7-10-13-25(35)14-11-8-5-6-9-12-15-26(32(43,31(41)42)21-28(36)37)29(38)34-27(30(39)40)20-23-16-18-24(22-33)19-17-23/h12,15-19,26-27,43H,2-11,13-14,20-21H2,1H3,(H,34,38)(H,36,37)(H,39,40)(H,41,42)/t26-,27+,32+/m1/s1 |
| InChIKey | LROQBKYHZMZDJG-CUJVHAHTSA-N |
| XLogP | 4.40 |
| TPSA | 202.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|