C37H50N2O10 — CID 20842644
2-[(E)-1-[[1-carboxy-2-[4-(5-methoxy-3-pyridinyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 20842644) has the molecular formula C37H50N2O10 and a molecular weight of 682.81 g/mol. Its IUPAC name is 2-[(E)-1-[[1-carboxy-2-[4-(5-methoxy-3-pyridinyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[(E)-1-[[1-carboxy-2-[4-(5-methoxy-3-pyridinyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 20842644 |
| Molecular Formula | C37H50N2O10 |
| Molecular Weight | 682.81 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 2-[(E)-1-[[1-carboxy-2-[4-(5-methoxy-3-pyridinyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C(C(=O)NC(Cc1ccc(-c2cncc(OC)c2)cc1)C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C37H50N2O10/c1-3-4-5-8-11-14-29(40)15-12-9-6-7-10-13-16-31(37(48,36(46)47)23-33(41)42)34(43)39-32(35(44)45)21-26-17-19-27(20-18-26)28-22-30(49-2)25-38-24-28/h13,16-20,22,24-25,31-32,48H,3-12,14-15,21,23H2,1-2H3,(H,39,43)(H,41,42)(H,44,45)(H,46,47)/b16-13+ |
| InChIKey | SALKTZKMNJTHFK-DTQAZKPQSA-N |
| XLogP | 5.60 |
| TPSA | 200.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.81 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|