C36H50N2O10 — CID 91481928
(2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 91481928) has the molecular formula C36H50N2O10 and a molecular weight of 670.80 g/mol. Its IUPAC name is (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 91481928 |
| Molecular Formula | C36H50N2O10 |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(-c2c(C)noc2C)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C36H50N2O10/c1-4-5-6-9-12-15-28(39)16-13-10-7-8-11-14-17-29(36(47,35(45)46)23-31(40)41)33(42)37-30(34(43)44)22-26-18-20-27(21-19-26)32-24(2)38-48-25(32)3/h14,17-21,29-30,47H,4-13,15-16,22-23H2,1-3H3,(H,37,42)(H,40,41)(H,43,44)(H,45,46)/t29-,30+,36+/m1/s1 |
| InChIKey | FLZFMYLXQQLLOT-ZMAZKXACSA-N |
| XLogP | 5.80 |
| TPSA | 204.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|