C34H47N3O10 — CID 6480384
(2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(4-methyl-1,2,5-oxadiazol-3-yl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 6480384) has the molecular formula C34H47N3O10 and a molecular weight of 657.76 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(4-methyl-1,2,5-oxadiazol-3-yl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(4-methyl-1,2,5-oxadiazol-3-yl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 6480384 |
| Molecular Formula | C34H47N3O10 |
| Molecular Weight | 657.76 g/mol |
| Exact Mass | 657.33 |
| IUPAC Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(4-methyl-1,2,5-oxadiazol-3-yl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(-c2nonc2C)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C34H47N3O10/c1-3-4-5-8-11-14-26(38)15-12-9-6-7-10-13-16-27(34(46,33(44)45)22-29(39)40)31(41)35-28(32(42)43)21-24-17-19-25(20-18-24)30-23(2)36-47-37-30/h13,16-20,27-28,46H,3-12,14-15,21-22H2,1-2H3,(H,35,41)(H,39,40)(H,42,43)(H,44,45)/b16-13+/t27-,28+,34+/m1/s1 |
| InChIKey | MXRPARXMTJNANU-JWKOSURTSA-N |
| XLogP | 4.89 |
| TPSA | 217.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.76 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|