C35H47N3O9 — CID 20842642
2-[(E)-1-[[1-carboxy-2-(4-pyrimidin-4-ylphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 20842642) has the molecular formula C35H47N3O9 and a molecular weight of 653.77 g/mol. Its IUPAC name is 2-[(E)-1-[[1-carboxy-2-(4-pyrimidin-4-ylphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[(E)-1-[[1-carboxy-2-(4-pyrimidin-4-ylphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 20842642 |
| Molecular Formula | C35H47N3O9 |
| Molecular Weight | 653.77 g/mol |
| Exact Mass | 653.33 |
| IUPAC Name | 2-[(E)-1-[[1-carboxy-2-(4-pyrimidin-4-ylphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C(C(=O)NC(Cc1ccc(-c2ccncn2)cc1)C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C35H47N3O9/c1-2-3-4-7-10-13-27(39)14-11-8-5-6-9-12-15-28(35(47,34(45)46)23-31(40)41)32(42)38-30(33(43)44)22-25-16-18-26(19-17-25)29-20-21-36-24-37-29/h12,15-21,24,28,30,47H,2-11,13-14,22-23H2,1H3,(H,38,42)(H,40,41)(H,43,44)(H,45,46)/b15-12+ |
| InChIKey | CDHBODKAFSJPEP-NTCAYCPXSA-N |
| XLogP | 4.99 |
| TPSA | 204.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.77 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|