C37H47F2NO9 — CID 6321035
(2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(2,4-difluorophenyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 6321035) has the molecular formula C37H47F2NO9 and a molecular weight of 687.78 g/mol. Its IUPAC name is (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(2,4-difluorophenyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(2,4-difluorophenyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 6321035 |
| Molecular Formula | C37H47F2NO9 |
| Molecular Weight | 687.78 g/mol |
| Exact Mass | 687.32 |
| IUPAC Name | (2S)-2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(2,4-difluorophenyl)phenyl]ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCCC=C[C@H](C(=O)N[C@@H](Cc1ccc(-c2ccc(F)cc2F)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C37H47F2NO9/c1-2-3-4-7-10-13-28(41)14-11-8-5-6-9-12-15-30(37(49,36(47)48)24-33(42)43)34(44)40-32(35(45)46)22-25-16-18-26(19-17-25)29-21-20-27(38)23-31(29)39/h12,15-21,23,30,32,49H,2-11,13-14,22,24H2,1H3,(H,40,44)(H,42,43)(H,45,46)(H,47,48)/t30-,32+,37+/m1/s1 |
| InChIKey | JVDOGNOKWPGINP-IDOZNTNQSA-N |
| XLogP | 6.48 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.78 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|