C37H55NO10 — CID 90875719
2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-13-cyclohexyl-1,11-dioxotridec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 90875719) has the molecular formula C37H55NO10 and a molecular weight of 673.84 g/mol. Its IUPAC name is 2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-13-cyclohexyl-1,11-dioxotridec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-13-cyclohexyl-1,11-dioxotridec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 90875719 |
| Molecular Formula | C37H55NO10 |
| Molecular Weight | 673.84 g/mol |
| Exact Mass | 673.38 |
| IUPAC Name | 2-[(2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-13-cyclohexyl-1,11-dioxotridec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CC(C)CCOc1ccc(C[C@H](NC(=O)C(C=CCCCCCCC(=O)CCC2CCCCC2)C(O)(CC(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C37H55NO10/c1-26(2)22-23-48-30-20-17-28(18-21-30)24-32(35(43)44)38-34(42)31(37(47,36(45)46)25-33(40)41)15-11-6-4-3-5-10-14-29(39)19-16-27-12-8-7-9-13-27/h11,15,17-18,20-21,26-27,31-32,47H,3-10,12-14,16,19,22-25H2,1-2H3,(H,38,42)(H,40,41)(H,43,44)(H,45,46)/t31?,32-,37?/m0/s1 |
| InChIKey | OLWIVOJQCJFCJZ-FVAPQORXSA-N |
| XLogP | 5.96 |
| TPSA | 187.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.84 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|