C39H55NO12 — CID 118870832
(E,4S)-3-[(1S)-1-acetyloxyethoxy]carbonyl-4-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-3-hydroxy-13-oxoicos-5-enoic acid (PubChem CID 118870832) has the molecular formula C39H55NO12 and a molecular weight of 729.86 g/mol. Its IUPAC name is (E,4S)-3-[(1S)-1-acetyloxyethoxy]carbonyl-4-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-3-hydroxy-13-oxoicos-5-enoic acid.
| Compound Name | (E,4S)-3-[(1S)-1-acetyloxyethoxy]carbonyl-4-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-3-hydroxy-13-oxoicos-5-enoic acid |
|---|---|
| PubChem CID | 118870832 |
| Molecular Formula | C39H55NO12 |
| Molecular Weight | 729.86 g/mol |
| Exact Mass | 729.37 |
| IUPAC Name | (E,4S)-3-[(1S)-1-acetyloxyethoxy]carbonyl-4-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]carbamoyl]-3-hydroxy-13-oxoicos-5-enoic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)C(O)(CC(=O)O)C(=O)O[C@@H](C)OC(C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C39H55NO12/c1-5-7-9-12-15-18-31(42)19-16-13-10-11-14-17-20-33(39(49,27-35(43)44)38(48)52-29(4)51-28(3)41)36(45)40-34(37(46)47)26-30-21-23-32(24-22-30)50-25-8-6-2/h17,20-24,29,33-34,49H,5,7,9-16,18-19,25-27H2,1-4H3,(H,40,45)(H,43,44)(H,46,47)/b20-17+/t29-,33+,34-,39?/m0/s1 |
| InChIKey | SSMLESPKAKDGKI-RQQVOYBTSA-N |
| XLogP | 5.30 |
| TPSA | 202.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|