C35H49NO9 — CID 71017939
(2R)-2-[(E)-1-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid (PubChem CID 71017939) has the molecular formula C35H49NO9 and a molecular weight of 627.78 g/mol. Its IUPAC name is (2R)-2-[(E)-1-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid.
| Compound Name | (2R)-2-[(E)-1-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid |
|---|---|
| PubChem CID | 71017939 |
| Molecular Formula | C35H49NO9 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | (2R)-2-[(E)-1-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxyethyl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)C(/C=C/CCCCCCC(=O)CCCCCCC)[C@@H](CC(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C35H49NO9/c1-3-5-7-10-13-16-27(37)17-14-11-8-9-12-15-18-29(30(34(41)42)25-32(38)39)33(40)36-31(35(43)44)24-26-19-21-28(22-20-26)45-23-6-4-2/h15,18-22,29-31H,3,5,7-14,16-17,23-25H2,1-2H3,(H,36,40)(H,38,39)(H,41,42)(H,43,44)/b18-15+/t29?,30-,31+/m1/s1 |
| InChIKey | YRQFETDQMBVQCA-VPYBNYDPSA-N |
| XLogP | 5.82 |
| TPSA | 167.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|