C42H64N2O9 — CID 144573494
butyl (E,2R,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]carbamoyl]-2-(2-hydroxyethyl)-12-oxononadec-4-enoate (PubChem CID 144573494) has the molecular formula C42H64N2O9 and a molecular weight of 740.98 g/mol. Its IUPAC name is butyl (E,2R,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]carbamoyl]-2-(2-hydroxyethyl)-12-oxononadec-4-enoate.
| Compound Name | butyl (E,2R,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]carbamoyl]-2-(2-hydroxyethyl)-12-oxononadec-4-enoate |
|---|---|
| PubChem CID | 144573494 |
| Molecular Formula | C42H64N2O9 |
| Molecular Weight | 740.98 g/mol |
| Exact Mass | 740.46 |
| IUPAC Name | butyl (E,2R,3S)-3-[[(2S)-3-(4-but-2-ynoxyphenyl)-1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]carbamoyl]-2-(2-hydroxyethyl)-12-oxononadec-4-enoate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)C(/C=C/CCCCCCC(=O)CCCCCCC)[C@@H](CCO)C(=O)OCCCC)C(=O)NCC(=O)OC)cc1 |
| InChI | InChI=1S/C42H64N2O9/c1-5-8-11-14-17-20-34(46)21-18-15-12-13-16-19-22-36(37(27-28-45)42(50)53-30-10-7-3)40(48)44-38(41(49)43-32-39(47)51-4)31-33-23-25-35(26-24-33)52-29-9-6-2/h19,22-26,36-38,45H,5,7-8,10-18,20-21,27-32H2,1-4H3,(H,43,49)(H,44,48)/b22-19+/t36?,37-,38+/m1/s1 |
| InChIKey | XTQDAQFHOFZRTA-BZAQIBEHSA-N |
| XLogP | 6.19 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.98 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|