C38H54N2Na2O9 — CID 140681691
disodium;(E,2R,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxylatoethyl]carbamoyl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]-12-oxononadec-4-enoate (PubChem CID 140681691) has the molecular formula C38H54N2Na2O9 and a molecular weight of 728.84 g/mol. Its IUPAC name is disodium;(E,2R,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxylatoethyl]carbamoyl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]-12-oxononadec-4-enoate.
| Compound Name | disodium;(E,2R,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxylatoethyl]carbamoyl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]-12-oxononadec-4-enoate |
|---|---|
| PubChem CID | 140681691 |
| Molecular Formula | C38H54N2Na2O9 |
| Molecular Weight | 728.84 g/mol |
| Exact Mass | 728.36 |
| IUPAC Name | disodium;(E,2R,3S)-3-[[(1S)-2-(4-but-2-ynoxyphenyl)-1-carboxylatoethyl]carbamoyl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]-12-oxononadec-4-enoate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)[C@@H](/C=C/CCCCCCC(=O)CCCCCCC)[C@@H](CC(=O)NCCOC)C(=O)[O-])C(=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C38H56N2O9.2Na/c1-4-6-8-11-14-17-30(41)18-15-12-9-10-13-16-19-32(33(37(44)45)28-35(42)39-24-26-48-3)36(43)40-34(38(46)47)27-29-20-22-31(23-21-29)49-25-7-5-2;;/h16,19-23,32-34H,4,6,8-15,17-18,24-28H2,1-3H3,(H,39,42)(H,40,43)(H,44,45)(H,46,47);;/q;2*+1/p-2/b19-16+;;/t32-,33+,34-;;/m0../s1 |
| InChIKey | HCDJTDZZXCKJGS-LVIZPPAASA-L |
| XLogP | -3.16 |
| TPSA | 173.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.84 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|