C37H55NO9 — CID 154558646
2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-cyclohexyloxyphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid (PubChem CID 154558646) has the molecular formula C37H55NO9 and a molecular weight of 657.84 g/mol. Its IUPAC name is 2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-cyclohexyloxyphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid.
| Compound Name | 2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-cyclohexyloxyphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid |
|---|---|
| PubChem CID | 154558646 |
| Molecular Formula | C37H55NO9 |
| Molecular Weight | 657.84 g/mol |
| Exact Mass | 657.39 |
| IUPAC Name | 2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-cyclohexyloxyphenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]butanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(OC2CCCCC2)cc1)C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C37H55NO9/c1-2-3-4-7-11-16-28(39)17-12-8-5-6-9-15-20-31(32(36(43)44)26-34(40)41)35(42)38-33(37(45)46)25-27-21-23-30(24-22-27)47-29-18-13-10-14-19-29/h15,20-24,29,31-33H,2-14,16-19,25-26H2,1H3,(H,38,42)(H,40,41)(H,43,44)(H,45,46)/b20-15+/t31-,32?,33-/m0/s1 |
| InChIKey | GTZIAXKSNONSLW-PEJYESQPSA-N |
| XLogP | 7.13 |
| TPSA | 167.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.84 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|