C33H51NO8 — CID 163791265
(E)-4-[[(1S)-1-carboxy-2-(3,4-dimethoxyphenyl)ethyl]carbamoyl]-3-methyl-13-oxoicos-5-enoic acid (PubChem CID 163791265) has the molecular formula C33H51NO8 and a molecular weight of 589.77 g/mol. Its IUPAC name is (E)-4-[[(1S)-1-carboxy-2-(3,4-dimethoxyphenyl)ethyl]carbamoyl]-3-methyl-13-oxoicos-5-enoic acid.
| Compound Name | (E)-4-[[(1S)-1-carboxy-2-(3,4-dimethoxyphenyl)ethyl]carbamoyl]-3-methyl-13-oxoicos-5-enoic acid |
|---|---|
| PubChem CID | 163791265 |
| Molecular Formula | C33H51NO8 |
| Molecular Weight | 589.77 g/mol |
| Exact Mass | 589.36 |
| IUPAC Name | (E)-4-[[(1S)-1-carboxy-2-(3,4-dimethoxyphenyl)ethyl]carbamoyl]-3-methyl-13-oxoicos-5-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C(C(=O)N[C@@H](Cc1ccc(OC)c(OC)c1)C(=O)O)C(C)CC(=O)O |
| InChI | InChI=1S/C33H51NO8/c1-5-6-7-10-13-16-26(35)17-14-11-8-9-12-15-18-27(24(2)21-31(36)37)32(38)34-28(33(39)40)22-25-19-20-29(41-3)30(23-25)42-4/h15,18-20,23-24,27-28H,5-14,16-17,21-22H2,1-4H3,(H,34,38)(H,36,37)(H,39,40)/b18-15+/t24?,27?,28-/m0/s1 |
| InChIKey | MWYUEMSAECUKLT-KKIXSHDWSA-N |
| XLogP | 6.37 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.77 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|