C37H51NO8 — CID 58696495
(E,3S,4S)-4-[[(1S)-1-carboxy-2-(4-phenoxyphenyl)ethyl]carbamoyl]-3-hydroxy-3-methyl-13-oxoicos-5-enoic acid (PubChem CID 58696495) has the molecular formula C37H51NO8 and a molecular weight of 637.81 g/mol. Its IUPAC name is (E,3S,4S)-4-[[(1S)-1-carboxy-2-(4-phenoxyphenyl)ethyl]carbamoyl]-3-hydroxy-3-methyl-13-oxoicos-5-enoic acid.
| Compound Name | (E,3S,4S)-4-[[(1S)-1-carboxy-2-(4-phenoxyphenyl)ethyl]carbamoyl]-3-hydroxy-3-methyl-13-oxoicos-5-enoic acid |
|---|---|
| PubChem CID | 58696495 |
| Molecular Formula | C37H51NO8 |
| Molecular Weight | 637.81 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | (E,3S,4S)-4-[[(1S)-1-carboxy-2-(4-phenoxyphenyl)ethyl]carbamoyl]-3-hydroxy-3-methyl-13-oxoicos-5-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(Oc2ccccc2)cc1)C(=O)O)[C@@](C)(O)CC(=O)O |
| InChI | InChI=1S/C37H51NO8/c1-3-4-5-8-12-17-29(39)18-13-9-6-7-10-16-21-32(37(2,45)27-34(40)41)35(42)38-33(36(43)44)26-28-22-24-31(25-23-28)46-30-19-14-11-15-20-30/h11,14-16,19-25,32-33,45H,3-10,12-13,17-18,26-27H2,1-2H3,(H,38,42)(H,40,41)(H,43,44)/b21-16+/t32-,33+,37+/m1/s1 |
| InChIKey | OOZLGGBAJLKKOB-RJAQLJSRSA-N |
| XLogP | 7.26 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.81 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|