C45H67NO8 — CID 58696462
tert-butyl (E,3S,4S)-3-hydroxy-3-methyl-4-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-(4-phenoxyphenyl)propan-2-yl]carbamoyl]-13-oxoicos-5-enoate (PubChem CID 58696462) has the molecular formula C45H67NO8 and a molecular weight of 750.03 g/mol. Its IUPAC name is tert-butyl (E,3S,4S)-3-hydroxy-3-methyl-4-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-(4-phenoxyphenyl)propan-2-yl]carbamoyl]-13-oxoicos-5-enoate.
| Compound Name | tert-butyl (E,3S,4S)-3-hydroxy-3-methyl-4-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-(4-phenoxyphenyl)propan-2-yl]carbamoyl]-13-oxoicos-5-enoate |
|---|---|
| PubChem CID | 58696462 |
| Molecular Formula | C45H67NO8 |
| Molecular Weight | 750.03 g/mol |
| Exact Mass | 749.49 |
| IUPAC Name | tert-butyl (E,3S,4S)-3-hydroxy-3-methyl-4-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-(4-phenoxyphenyl)propan-2-yl]carbamoyl]-13-oxoicos-5-enoate |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(Oc2ccccc2)cc1)C(=O)OC(C)(C)C)[C@@](C)(O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C45H67NO8/c1-9-10-11-14-18-23-35(47)24-19-15-12-13-16-22-27-38(45(8,51)33-40(48)53-43(2,3)4)41(49)46-39(42(50)54-44(5,6)7)32-34-28-30-37(31-29-34)52-36-25-20-17-21-26-36/h17,20-22,25-31,38-39,51H,9-16,18-19,23-24,32-33H2,1-8H3,(H,46,49)/b27-22+/t38-,39+,45+/m1/s1 |
| InChIKey | KWAVCACUINRJPN-PWDBWSKRSA-N |
| XLogP | 9.77 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.03 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|