C42H63NO7 — CID 59850491
tert-butyl (2S)-2-[[(E,2S)-2-[(2S)-2,4-dihydroxybutan-2-yl]-11-oxooctadec-3-enoyl]amino]-3-[4-(3-methoxyphenyl)phenyl]propanoate (PubChem CID 59850491) has the molecular formula C42H63NO7 and a molecular weight of 693.97 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(E,2S)-2-[(2S)-2,4-dihydroxybutan-2-yl]-11-oxooctadec-3-enoyl]amino]-3-[4-(3-methoxyphenyl)phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-[[(E,2S)-2-[(2S)-2,4-dihydroxybutan-2-yl]-11-oxooctadec-3-enoyl]amino]-3-[4-(3-methoxyphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 59850491 |
| Molecular Formula | C42H63NO7 |
| Molecular Weight | 693.97 g/mol |
| Exact Mass | 693.46 |
| IUPAC Name | tert-butyl (2S)-2-[[(E,2S)-2-[(2S)-2,4-dihydroxybutan-2-yl]-11-oxooctadec-3-enoyl]amino]-3-[4-(3-methoxyphenyl)phenyl]propanoate |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(-c2cccc(OC)c2)cc1)C(=O)OC(C)(C)C)[C@@](C)(O)CCO |
| InChI | InChI=1S/C42H63NO7/c1-7-8-9-12-15-20-35(45)21-16-13-10-11-14-17-23-37(42(5,48)28-29-44)39(46)43-38(40(47)50-41(2,3)4)30-32-24-26-33(27-25-32)34-19-18-22-36(31-34)49-6/h17-19,22-27,31,37-38,44,48H,7-16,20-21,28-30H2,1-6H3,(H,43,46)/b23-17+/t37-,38+,42+/m1/s1 |
| InChIKey | XVARBEXJYNITPV-HDYLNGRBSA-N |
| XLogP | 8.31 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.97 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|