C37H49NO9 — CID 142986545
2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxo-13-phenyltridec-3-en-2-yl]butanedioic acid (PubChem CID 142986545) has the molecular formula C37H49NO9 and a molecular weight of 651.80 g/mol. Its IUPAC name is 2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxo-13-phenyltridec-3-en-2-yl]butanedioic acid.
| Compound Name | 2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxo-13-phenyltridec-3-en-2-yl]butanedioic acid |
|---|---|
| PubChem CID | 142986545 |
| Molecular Formula | C37H49NO9 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | 2-[(E,2S)-1-[[(1S)-1-carboxy-2-[4-(3-methylbutoxy)phenyl]ethyl]amino]-1,11-dioxo-13-phenyltridec-3-en-2-yl]butanedioic acid |
| SMILES | CC(C)CCOc1ccc(C[C@H](NC(=O)C(/C=C/CCCCCCC(=O)CCc2ccccc2)C(CC(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C37H49NO9/c1-26(2)22-23-47-30-20-17-28(18-21-30)24-33(37(45)46)38-35(42)31(32(36(43)44)25-34(40)41)15-11-6-4-3-5-10-14-29(39)19-16-27-12-8-7-9-13-27/h7-9,11-13,15,17-18,20-21,26,31-33H,3-6,10,14,16,19,22-25H2,1-2H3,(H,38,42)(H,40,41)(H,43,44)(H,45,46)/b15-11+/t31?,32?,33-/m0/s1 |
| InChIKey | DYIKESCCNYBCNE-LENFSVTMSA-N |
| XLogP | 6.11 |
| TPSA | 167.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|