C28H36Hg2O4 — CID 20509677
[(E)-1,2-dicarboxy-1-(phenylmercurio)tetradec-3-enyl]-phenylmercury (PubChem CID 20509677) has the molecular formula C28H36Hg2O4 and a molecular weight of 837.77 g/mol. Its IUPAC name is [(E)-1,2-dicarboxy-1-(phenylmercurio)tetradec-3-enyl]-phenylmercury.
| Compound Name | [(E)-1,2-dicarboxy-1-(phenylmercurio)tetradec-3-enyl]-phenylmercury |
|---|---|
| PubChem CID | 20509677 |
| Molecular Formula | C28H36Hg2O4 |
| Molecular Weight | 837.77 g/mol |
| Exact Mass | 840.20 |
| IUPAC Name | [(E)-1,2-dicarboxy-1-(phenylmercurio)tetradec-3-enyl]-phenylmercury |
| SMILES | CCCCCCCCCC/C=C/C(C(=O)O)C([Hg]c1ccccc1)([Hg]c1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H26O4.2C6H5.2Hg/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;2*1-2-4-6-5-3-1;;/h11-12,14H,2-10H2,1H3,(H,17,18)(H,19,20);2*1-5H;;/b12-11+;;;; |
| InChIKey | SENBMEGOVWNJKY-MOSUJMLHSA-N |
| XLogP | 5.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.77 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|