About dodec-3-en-2-ylbenzene
dodec-3-en-2-ylbenzene (PubChem CID 140717956) has the molecular formula C18H28
and a molecular weight of 244.42 g/mol. Its IUPAC name is dodec-3-en-2-ylbenzene.
Molecular Properties
| Compound Name | dodec-3-en-2-ylbenzene |
| PubChem CID | 140717956 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | dodec-3-en-2-ylbenzene |
| SMILES | CCCCCCCCC=CC(C)c1ccccc1 |
| InChI | InChI=1S/C18H28/c1-3-4-5-6-7-8-9-11-14-17(2)18-15-12-10-13-16-18/h10-17H,3-9H2,1-2H3 |
| InChIKey | KBEJPTUCVMVWPO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dodec-3-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-3-en-2-ylbenzene?
The IUPAC name of dodec-3-en-2-ylbenzene (CID 140717956) is dodec-3-en-2-ylbenzene.
What is the SMILES notation for dodec-3-en-2-ylbenzene?
The canonical SMILES for dodec-3-en-2-ylbenzene is CCCCCCCCC=CC(C)c1ccccc1.
What is the InChIKey of dodec-3-en-2-ylbenzene?
The InChIKey is KBEJPTUCVMVWPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28/c1-3-4-5-6-7-8-9-11-14-17(2)18-15-12-10-13-16-18/h10-17H,3-9H2,1-2H3.
What are the key properties of dodec-3-en-2-ylbenzene?
dodec-3-en-2-ylbenzene has a molecular weight of 244.42 g/mol, XLogP of 6.10, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-3-en-2-ylbenzene is sourced from PubChem (CID 140717956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).