C25H35N — CID 101491741
(E,1S,2S)-N-benzyl-2-methyl-1-phenylundec-3-en-1-amine (PubChem CID 101491741) has the molecular formula C25H35N and a molecular weight of 349.56 g/mol. Its IUPAC name is (E,1S,2S)-N-benzyl-2-methyl-1-phenylundec-3-en-1-amine.
| Compound Name | (E,1S,2S)-N-benzyl-2-methyl-1-phenylundec-3-en-1-amine |
|---|---|
| PubChem CID | 101491741 |
| Molecular Formula | C25H35N |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | (E,1S,2S)-N-benzyl-2-methyl-1-phenylundec-3-en-1-amine |
| SMILES | CCCCCCC/C=C/[C@H](C)[C@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35N/c1-3-4-5-6-7-8-11-16-22(2)25(24-19-14-10-15-20-24)26-21-23-17-12-9-13-18-23/h9-20,22,25-26H,3-8,21H2,1-2H3/b16-11+/t22-,25-/m0/s1 |
| InChIKey | BBFGXIMZSYEIHU-ICUFOFBBSA-N |
| XLogP | 7.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|