About octadec-3-en-2-ylbenzene
octadec-3-en-2-ylbenzene (PubChem CID 140717946) has the molecular formula C24H40
and a molecular weight of 328.58 g/mol. Its IUPAC name is octadec-3-en-2-ylbenzene.
Molecular Properties
| Compound Name | octadec-3-en-2-ylbenzene |
| PubChem CID | 140717946 |
| Molecular Formula | C24H40 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | octadec-3-en-2-ylbenzene |
| SMILES | CCCCCCCCCCCCCCC=CC(C)c1ccccc1 |
| InChI | InChI=1S/C24H40/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(2)24-21-18-16-19-22-24/h16-23H,3-15H2,1-2H3 |
| InChIKey | YRVXRGCGVGAVHZ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octadec-3-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-3-en-2-ylbenzene?
The IUPAC name of octadec-3-en-2-ylbenzene (CID 140717946) is octadec-3-en-2-ylbenzene.
What is the SMILES notation for octadec-3-en-2-ylbenzene?
The canonical SMILES for octadec-3-en-2-ylbenzene is CCCCCCCCCCCCCCC=CC(C)c1ccccc1.
What is the InChIKey of octadec-3-en-2-ylbenzene?
The InChIKey is YRVXRGCGVGAVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(2)24-21-18-16-19-22-24/h16-23H,3-15H2,1-2H3.
What are the key properties of octadec-3-en-2-ylbenzene?
octadec-3-en-2-ylbenzene has a molecular weight of 328.58 g/mol, XLogP of 8.44, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-3-en-2-ylbenzene is sourced from PubChem (CID 140717946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).