C16H22F2O — CID 102600669
(Z)-2,2-difluoro-1-phenyldec-3-en-1-ol (PubChem CID 102600669) has the molecular formula C16H22F2O and a molecular weight of 268.35 g/mol. Its IUPAC name is (Z)-2,2-difluoro-1-phenyldec-3-en-1-ol.
| Compound Name | (Z)-2,2-difluoro-1-phenyldec-3-en-1-ol |
|---|---|
| PubChem CID | 102600669 |
| Molecular Formula | C16H22F2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (Z)-2,2-difluoro-1-phenyldec-3-en-1-ol |
| SMILES | CCCCCC/C=C\C(F)(F)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H22F2O/c1-2-3-4-5-6-10-13-16(17,18)15(19)14-11-8-7-9-12-14/h7-13,15,19H,2-6H2,1H3/b13-10- |
| InChIKey | OZLNXPMIVRLXIX-RAXLEYEMSA-N |
| XLogP | 4.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|