C17H26O — CID 102326663
(E,1S,2S)-2-butyl-2-methyl-1-phenylhex-3-en-1-ol (PubChem CID 102326663) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (E,1S,2S)-2-butyl-2-methyl-1-phenylhex-3-en-1-ol.
| Compound Name | (E,1S,2S)-2-butyl-2-methyl-1-phenylhex-3-en-1-ol |
|---|---|
| PubChem CID | 102326663 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (E,1S,2S)-2-butyl-2-methyl-1-phenylhex-3-en-1-ol |
| SMILES | CC/C=C/[C@](C)(CCCC)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H26O/c1-4-6-13-17(3,14-7-5-2)16(18)15-11-9-8-10-12-15/h6,8-13,16,18H,4-5,7,14H2,1-3H3/b13-6+/t16-,17-/m1/s1 |
| InChIKey | FDZQTVPHVZAUTK-QINFDYIYSA-N |
| XLogP | 4.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|