C29H56O7P2 — CID 158497128
dihydroxyphosphanyl dihydrogen phosphite;2,2-dimethyl-3-nonyl-1-phenyldodecane-1,3-diol (PubChem CID 158497128) has the molecular formula C29H56O7P2 and a molecular weight of 578.71 g/mol. Its IUPAC name is dihydroxyphosphanyl dihydrogen phosphite;2,2-dimethyl-3-nonyl-1-phenyldodecane-1,3-diol.
| Compound Name | dihydroxyphosphanyl dihydrogen phosphite;2,2-dimethyl-3-nonyl-1-phenyldodecane-1,3-diol |
|---|---|
| PubChem CID | 158497128 |
| Molecular Formula | C29H56O7P2 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | dihydroxyphosphanyl dihydrogen phosphite;2,2-dimethyl-3-nonyl-1-phenyldodecane-1,3-diol |
| SMILES | CCCCCCCCCC(O)(CCCCCCCCC)C(C)(C)C(O)c1ccccc1.OP(O)OP(O)O |
| InChI | InChI=1S/C29H52O2.H4O5P2/c1-5-7-9-11-13-15-20-24-29(31,25-21-16-14-12-10-8-6-2)28(3,4)27(30)26-22-18-17-19-23-26;1-6(2)5-7(3)4/h17-19,22-23,27,30-31H,5-16,20-21,24-25H2,1-4H3;1-4H |
| InChIKey | HJKYAESNOZLTMA-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|