C21H48O9P2 — CID 158240195
2,2-bis(hydroxymethyl)-3-octylundecane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite (PubChem CID 158240195) has the molecular formula C21H48O9P2 and a molecular weight of 506.55 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)-3-octylundecane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite.
| Compound Name | 2,2-bis(hydroxymethyl)-3-octylundecane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite |
|---|---|
| PubChem CID | 158240195 |
| Molecular Formula | C21H48O9P2 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 2,2-bis(hydroxymethyl)-3-octylundecane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite |
| SMILES | CCCCCCCCC(O)(CCCCCCCC)C(CO)(CO)CO.OP(O)OP(O)O |
| InChI | InChI=1S/C21H44O4.H4O5P2/c1-3-5-7-9-11-13-15-21(25,20(17-22,18-23)19-24)16-14-12-10-8-6-4-2;1-6(2)5-7(3)4/h22-25H,3-19H2,1-2H3;1-4H |
| InChIKey | GFLIYGDOQWRMTI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|