C25H58O10P2 — CID 159512974
2,2-bis(hydroxymethyl)-11-methyl-3-(8-methylnonyl)dodecane-1,3-diol;phosphorous acid (PubChem CID 159512974) has the molecular formula C25H58O10P2 and a molecular weight of 580.68 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)-11-methyl-3-(8-methylnonyl)dodecane-1,3-diol;phosphorous acid.
| Compound Name | 2,2-bis(hydroxymethyl)-11-methyl-3-(8-methylnonyl)dodecane-1,3-diol;phosphorous acid |
|---|---|
| PubChem CID | 159512974 |
| Molecular Formula | C25H58O10P2 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | 2,2-bis(hydroxymethyl)-11-methyl-3-(8-methylnonyl)dodecane-1,3-diol;phosphorous acid |
| SMILES | CC(C)CCCCCCCC(O)(CCCCCCCC(C)C)C(CO)(CO)CO.OP(O)O.OP(O)O |
| InChI | InChI=1S/C25H52O4.2H3O3P/c1-22(2)15-11-7-5-9-13-17-25(29,24(19-26,20-27)21-28)18-14-10-6-8-12-16-23(3)4;2*1-4(2)3/h22-23,26-29H,5-21H2,1-4H3;2*1-3H |
| InChIKey | MAVHGXWMRMSRFY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|