About dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol
dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol (PubChem CID 158686302) has the molecular formula C9H24O9P2
and a molecular weight of 338.23 g/mol. Its IUPAC name is dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol.
Molecular Properties
| Compound Name | dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol |
| PubChem CID | 158686302 |
| Molecular Formula | C9H24O9P2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol |
| SMILES | CCC(O)(CC)C(CO)(CO)CO.OP(O)OP(O)O |
| InChI | InChI=1S/C9H20O4.H4O5P2/c1-3-9(13,4-2)8(5-10,6-11)7-12;1-6(2)5-7(3)4/h10-13H,3-7H2,1-2H3;1-4H |
| InChIKey | IFTZOWKEQLZNMT-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol?
The IUPAC name of dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol (CID 158686302) is dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol.
What is the SMILES notation for dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol?
The canonical SMILES for dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol is CCC(O)(CC)C(CO)(CO)CO.OP(O)OP(O)O.
What is the InChIKey of dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol?
The InChIKey is IFTZOWKEQLZNMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O4.H4O5P2/c1-3-9(13,4-2)8(5-10,6-11)7-12;1-6(2)5-7(3)4/h10-13H,3-7H2,1-2H3;1-4H.
What are the key properties of dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol?
dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol has a molecular weight of 338.23 g/mol, XLogP of -1.07, 8 rotatable bonds, 8 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxyphosphanyl dihydrogen phosphite;3-ethyl-2,2-bis(hydroxymethyl)pentane-1,3-diol is sourced from PubChem (CID 158686302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).