C33H56O9P2 — CID 158506622
1,1-bis(2,6-dibutylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite (PubChem CID 158506622) has the molecular formula C33H56O9P2 and a molecular weight of 658.75 g/mol. Its IUPAC name is 1,1-bis(2,6-dibutylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite.
| Compound Name | 1,1-bis(2,6-dibutylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite |
|---|---|
| PubChem CID | 158506622 |
| Molecular Formula | C33H56O9P2 |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | 1,1-bis(2,6-dibutylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite |
| SMILES | CCCCc1cccc(CCCC)c1C(O)(c1c(CCCC)cccc1CCCC)C(CO)(CO)CO.OP(O)OP(O)O |
| InChI | InChI=1S/C33H52O4.H4O5P2/c1-5-9-15-26-19-13-20-27(16-10-6-2)30(26)33(37,32(23-34,24-35)25-36)31-28(17-11-7-3)21-14-22-29(31)18-12-8-4;1-6(2)5-7(3)4/h13-14,19-22,34-37H,5-12,15-18,23-25H2,1-4H3;1-4H |
| InChIKey | HKNRVKUOULWVEJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|