C18H26O — CID 11357371
(E,4R)-4-phenyldodec-5-en-2-one (PubChem CID 11357371) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (E,4R)-4-phenyldodec-5-en-2-one.
| Compound Name | (E,4R)-4-phenyldodec-5-en-2-one |
|---|---|
| PubChem CID | 11357371 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (E,4R)-4-phenyldodec-5-en-2-one |
| SMILES | CCCCCC/C=C/[C@@H](CC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O/c1-3-4-5-6-7-9-14-18(15-16(2)19)17-12-10-8-11-13-17/h8-14,18H,3-7,15H2,1-2H3/b14-9+/t18-/m0/s1 |
| InChIKey | LBBJULJDTOOZOA-MXHVWWQHSA-N |
| XLogP | 5.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|