C19H18O2 — CID 12655089
(E)-1,4-diphenylhept-2-ene-1,6-dione (PubChem CID 12655089) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is (E)-1,4-diphenylhept-2-ene-1,6-dione.
| Compound Name | (E)-1,4-diphenylhept-2-ene-1,6-dione |
|---|---|
| PubChem CID | 12655089 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (E)-1,4-diphenylhept-2-ene-1,6-dione |
| SMILES | CC(=O)CC(/C=C/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O2/c1-15(20)14-18(16-8-4-2-5-9-16)12-13-19(21)17-10-6-3-7-11-17/h2-13,18H,14H2,1H3/b13-12+ |
| InChIKey | YVANNECUYUPGHO-OUKQBFOZSA-N |
| XLogP | 4.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|