C16H22O — CID 102273779
(E,4R)-4-methyl-1-phenylnon-2-en-1-one (PubChem CID 102273779) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (E,4R)-4-methyl-1-phenylnon-2-en-1-one.
| Compound Name | (E,4R)-4-methyl-1-phenylnon-2-en-1-one |
|---|---|
| PubChem CID | 102273779 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (E,4R)-4-methyl-1-phenylnon-2-en-1-one |
| SMILES | CCCCC[C@@H](C)/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-3-4-6-9-14(2)12-13-16(17)15-10-7-5-8-11-15/h5,7-8,10-14H,3-4,6,9H2,1-2H3/b13-12+/t14-/m1/s1 |
| InChIKey | LXZGDFKGLQJQIQ-XTZCOPOCSA-N |
| XLogP | 4.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|