C31H54ClNO — CID 173064336
diethyl-octadec-9-enoyl-(1-phenylpropyl)azanium chloride (PubChem CID 173064336) has the molecular formula C31H54ClNO and a molecular weight of 492.23 g/mol. Its IUPAC name is diethyl-octadec-9-enoyl-(1-phenylpropyl)azanium chloride.
| Compound Name | diethyl-octadec-9-enoyl-(1-phenylpropyl)azanium chloride |
|---|---|
| PubChem CID | 173064336 |
| Molecular Formula | C31H54ClNO |
| Molecular Weight | 492.23 g/mol |
| Exact Mass | 491.39 |
| IUPAC Name | diethyl-octadec-9-enoyl-(1-phenylpropyl)azanium chloride |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)[N+](CC)(CC)C(CC)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C31H54NO.ClH/c1-5-9-10-11-12-13-14-15-16-17-18-19-20-21-25-28-31(33)32(7-3,8-4)30(6-2)29-26-23-22-24-27-29;/h15-16,22-24,26-27,30H,5-14,17-21,25,28H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | NNDGWUQJGCDZDP-UHFFFAOYSA-M |
| XLogP | 6.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.23 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|