C26H29N — CID 101465131
(Z,1R,2R)-N-benzyl-2-methyl-1,6-diphenylhex-3-en-1-amine (PubChem CID 101465131) has the molecular formula C26H29N and a molecular weight of 355.53 g/mol. Its IUPAC name is (Z,1R,2R)-N-benzyl-2-methyl-1,6-diphenylhex-3-en-1-amine.
| Compound Name | (Z,1R,2R)-N-benzyl-2-methyl-1,6-diphenylhex-3-en-1-amine |
|---|---|
| PubChem CID | 101465131 |
| Molecular Formula | C26H29N |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | (Z,1R,2R)-N-benzyl-2-methyl-1,6-diphenylhex-3-en-1-amine |
| SMILES | C[C@H](/C=C\CCc1ccccc1)[C@@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N/c1-22(13-11-12-16-23-14-5-2-6-15-23)26(25-19-9-4-10-20-25)27-21-24-17-7-3-8-18-24/h2-11,13-15,17-20,22,26-27H,12,16,21H2,1H3/b13-11-/t22-,26-/m1/s1 |
| InChIKey | AZSJOWBTKSZBMQ-AHSRSXCNSA-N |
| XLogP | 6.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|