C13H18O2 — CID 102219154
[(Z)-5,5-dimethoxypent-3-enyl]benzene (PubChem CID 102219154) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is [(Z)-5,5-dimethoxypent-3-enyl]benzene.
| Compound Name | [(Z)-5,5-dimethoxypent-3-enyl]benzene |
|---|---|
| PubChem CID | 102219154 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | [(Z)-5,5-dimethoxypent-3-enyl]benzene |
| SMILES | COC(/C=C\CCc1ccccc1)OC |
| InChI | InChI=1S/C13H18O2/c1-14-13(15-2)11-7-6-10-12-8-4-3-5-9-12/h3-5,7-9,11,13H,6,10H2,1-2H3/b11-7- |
| InChIKey | HTQUPQUQXICBKN-XFFZJAGNSA-N |
| XLogP | 2.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|