C14H20O2 — CID 10656559
[(E)-5,5-dimethoxyhex-3-enyl]benzene (PubChem CID 10656559) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is [(E)-5,5-dimethoxyhex-3-enyl]benzene.
| Compound Name | [(E)-5,5-dimethoxyhex-3-enyl]benzene |
|---|---|
| PubChem CID | 10656559 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | [(E)-5,5-dimethoxyhex-3-enyl]benzene |
| SMILES | COC(C)(/C=C/CCc1ccccc1)OC |
| InChI | InChI=1S/C14H20O2/c1-14(15-2,16-3)12-8-7-11-13-9-5-4-6-10-13/h4-6,8-10,12H,7,11H2,1-3H3/b12-8+ |
| InChIKey | UADZDEXAZQFZOD-XYOKQWHBSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|