C26H27NO2 — CID 53392360
[[(E,1S,2S)-2-methyl-1,6-diphenylhex-3-enyl]amino] benzoate (PubChem CID 53392360) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is [[(E,1S,2S)-2-methyl-1,6-diphenylhex-3-enyl]amino] benzoate.
| Compound Name | [[(E,1S,2S)-2-methyl-1,6-diphenylhex-3-enyl]amino] benzoate |
|---|---|
| PubChem CID | 53392360 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [[(E,1S,2S)-2-methyl-1,6-diphenylhex-3-enyl]amino] benzoate |
| SMILES | C[C@@H](/C=C/CCc1ccccc1)[C@H](NOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO2/c1-21(13-11-12-16-22-14-5-2-6-15-22)25(23-17-7-3-8-18-23)27-29-26(28)24-19-9-4-10-20-24/h2-11,13-15,17-21,25,27H,12,16H2,1H3/b13-11+/t21-,25-/m0/s1 |
| InChIKey | OYMHNLYAVBIFHN-SBNLUSQCSA-N |
| XLogP | 5.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|