About (3-phenylpropylamino) benzoate
(3-phenylpropylamino) benzoate (PubChem CID 87745139) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is (3-phenylpropylamino) benzoate.
Molecular Properties
| Compound Name | (3-phenylpropylamino) benzoate |
| PubChem CID | 87745139 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (3-phenylpropylamino) benzoate |
| SMILES | O=C(ONCCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c18-16(15-11-5-2-6-12-15)19-17-13-7-10-14-8-3-1-4-9-14/h1-6,8-9,11-12,17H,7,10,13H2 |
| InChIKey | XBKIMLQSIXNRRM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-phenylpropylamino) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylpropylamino) benzoate?
The IUPAC name of (3-phenylpropylamino) benzoate (CID 87745139) is (3-phenylpropylamino) benzoate.
What is the SMILES notation for (3-phenylpropylamino) benzoate?
The canonical SMILES for (3-phenylpropylamino) benzoate is O=C(ONCCCc1ccccc1)c1ccccc1.
What is the InChIKey of (3-phenylpropylamino) benzoate?
The InChIKey is XBKIMLQSIXNRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c18-16(15-11-5-2-6-12-15)19-17-13-7-10-14-8-3-1-4-9-14/h1-6,8-9,11-12,17H,7,10,13H2.
What are the key properties of (3-phenylpropylamino) benzoate?
(3-phenylpropylamino) benzoate has a molecular weight of 255.32 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylpropylamino) benzoate is sourced from PubChem (CID 87745139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).