C21H25N3O5 — CID 134386730
[[5-(benzoyloxyamino)-6-(methylamino)-6-oxohexyl]amino] benzoate (PubChem CID 134386730) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is [[5-(benzoyloxyamino)-6-(methylamino)-6-oxohexyl]amino] benzoate.
| Compound Name | [[5-(benzoyloxyamino)-6-(methylamino)-6-oxohexyl]amino] benzoate |
|---|---|
| PubChem CID | 134386730 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [[5-(benzoyloxyamino)-6-(methylamino)-6-oxohexyl]amino] benzoate |
| SMILES | CNC(=O)C(CCCCNOC(=O)c1ccccc1)NOC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O5/c1-22-19(25)18(24-29-21(27)17-12-6-3-7-13-17)14-8-9-15-23-28-20(26)16-10-4-2-5-11-16/h2-7,10-13,18,23-24H,8-9,14-15H2,1H3,(H,22,25) |
| InChIKey | ANESAIOIAPLQLB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|