C18H28N2O6 — CID 123944877
[[6,6-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]amino] benzoate (PubChem CID 123944877) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is [[6,6-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]amino] benzoate.
| Compound Name | [[6,6-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]amino] benzoate |
|---|---|
| PubChem CID | 123944877 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [[6,6-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]amino] benzoate |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNOC(=O)c1ccccc1)C(O)O |
| InChI | InChI=1S/C18H28N2O6/c1-18(2,3)25-17(24)20-14(15(21)22)11-7-8-12-19-26-16(23)13-9-5-4-6-10-13/h4-6,9-10,14-15,19,21-22H,7-8,11-12H2,1-3H3,(H,20,24) |
| InChIKey | BZJNGUJGKGWWJM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|