C21H32N2O6 — CID 163764546
[[(2S)-1-methoxy-6-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxoheptan-2-yl]amino] benzoate (PubChem CID 163764546) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is [[(2S)-1-methoxy-6-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxoheptan-2-yl]amino] benzoate.
| Compound Name | [[(2S)-1-methoxy-6-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxoheptan-2-yl]amino] benzoate |
|---|---|
| PubChem CID | 163764546 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | [[(2S)-1-methoxy-6-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxoheptan-2-yl]amino] benzoate |
| SMILES | COC(=O)[C@H](CCCC(C)(C)NC(=O)OC(C)(C)C)NOC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H32N2O6/c1-20(2,3)28-19(26)22-21(4,5)14-10-13-16(18(25)27-6)23-29-17(24)15-11-8-7-9-12-15/h7-9,11-12,16,23H,10,13-14H2,1-6H3,(H,22,26)/t16-/m0/s1 |
| InChIKey | MBCQGSBXHVWDBE-INIZCTEOSA-N |
| XLogP | 3.36 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|