C25H43N3O5 — CID 123810408
[[6-[(6-hydroxy-6-methoxy-2,2,4,4-tetramethylhexyl)amino]-5-(methylamino)-6-oxohexyl]amino] benzoate (PubChem CID 123810408) has the molecular formula C25H43N3O5 and a molecular weight of 465.64 g/mol. Its IUPAC name is [[6-[(6-hydroxy-6-methoxy-2,2,4,4-tetramethylhexyl)amino]-5-(methylamino)-6-oxohexyl]amino] benzoate.
| Compound Name | [[6-[(6-hydroxy-6-methoxy-2,2,4,4-tetramethylhexyl)amino]-5-(methylamino)-6-oxohexyl]amino] benzoate |
|---|---|
| PubChem CID | 123810408 |
| Molecular Formula | C25H43N3O5 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | [[6-[(6-hydroxy-6-methoxy-2,2,4,4-tetramethylhexyl)amino]-5-(methylamino)-6-oxohexyl]amino] benzoate |
| SMILES | CNC(CCCCNOC(=O)c1ccccc1)C(=O)NCC(C)(C)CC(C)(C)CC(O)OC |
| InChI | InChI=1S/C25H43N3O5/c1-24(2,16-21(29)32-6)17-25(3,4)18-27-22(30)20(26-5)14-10-11-15-28-33-23(31)19-12-8-7-9-13-19/h7-9,12-13,20-21,26,28-29H,10-11,14-18H2,1-6H3,(H,27,30) |
| InChIKey | INRYYRMABAPQKJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|