C21H39N3O3 — CID 90749527
N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]benzamide;1-methoxypropane;propane (PubChem CID 90749527) has the molecular formula C21H39N3O3 and a molecular weight of 381.56 g/mol. Its IUPAC name is N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]benzamide;1-methoxypropane;propane.
| Compound Name | N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]benzamide;1-methoxypropane;propane |
|---|---|
| PubChem CID | 90749527 |
| Molecular Formula | C21H39N3O3 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]benzamide;1-methoxypropane;propane |
| SMILES | CCC.CCCOC.CN[C@@H](CCCCNC(=O)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C14H21N3O2.C4H10O.C3H8/c1-16-12(13(15)18)9-5-6-10-17-14(19)11-7-3-2-4-8-11;1-3-4-5-2;1-3-2/h2-4,7-8,12,16H,5-6,9-10H2,1H3,(H2,15,18)(H,17,19);3-4H2,1-2H3;3H2,1-2H3/t12-;;/m0../s1 |
| InChIKey | LXGDTBPDWRLXEO-LTCKWSDVSA-N |
| XLogP | 3.12 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|