C25H42N4O6 — CID 90882710
N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-3-[[(Z)-5-(2,3-dimethoxypropoxy)pentylideneamino]oxymethyl]benzamide (PubChem CID 90882710) has the molecular formula C25H42N4O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-3-[[(Z)-5-(2,3-dimethoxypropoxy)pentylideneamino]oxymethyl]benzamide.
| Compound Name | N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-3-[[(Z)-5-(2,3-dimethoxypropoxy)pentylideneamino]oxymethyl]benzamide |
|---|---|
| PubChem CID | 90882710 |
| Molecular Formula | C25H42N4O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-3-[[(Z)-5-(2,3-dimethoxypropoxy)pentylideneamino]oxymethyl]benzamide |
| SMILES | CN[C@@H](CCCCNC(=O)c1cccc(CO/N=C\CCCCOCC(COC)OC)c1)C(N)=O |
| InChI | InChI=1S/C25H42N4O6/c1-27-23(24(26)30)12-5-7-13-28-25(31)21-11-9-10-20(16-21)17-35-29-14-6-4-8-15-34-19-22(33-3)18-32-2/h9-11,14,16,22-23,27H,4-8,12-13,15,17-19H2,1-3H3,(H2,26,30)(H,28,31)/b29-14-/t22?,23-/m0/s1 |
| InChIKey | KASDVWWTORVURL-VYXUSFRTSA-N |
| XLogP | 2.01 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|