C14H23N4O2+ — CID 147379638
[4-[[6-amino-5-(methylamino)-6-oxohexyl]carbamoyl]phenyl]azanium (PubChem CID 147379638) has the molecular formula C14H23N4O2+ and a molecular weight of 279.36 g/mol. Its IUPAC name is [4-[[6-amino-5-(methylamino)-6-oxohexyl]carbamoyl]phenyl]azanium.
| Compound Name | [4-[[6-amino-5-(methylamino)-6-oxohexyl]carbamoyl]phenyl]azanium |
|---|---|
| PubChem CID | 147379638 |
| Molecular Formula | C14H23N4O2+ |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | [4-[[6-amino-5-(methylamino)-6-oxohexyl]carbamoyl]phenyl]azanium |
| SMILES | CNC(CCCCNC(=O)c1ccc([NH3+])cc1)C(N)=O |
| InChI | InChI=1S/C14H22N4O2/c1-17-12(13(16)19)4-2-3-9-18-14(20)10-5-7-11(15)8-6-10/h5-8,12,17H,2-4,9,15H2,1H3,(H2,16,19)(H,18,20)/p+1 |
| InChIKey | DKSDLINXDWQWEW-UHFFFAOYSA-O |
| XLogP | -0.47 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|