C24H39N5O10S2 — CID 157359366
(2R,5R)-5-[[(2S)-1-amino-1-oxo-6-[[4-(propylamino)benzoyl]amino]hexan-2-yl]carbamoyl]-2-(methylamino)-3-oxohexane-1,6-disulfonic acid (PubChem CID 157359366) has the molecular formula C24H39N5O10S2 and a molecular weight of 621.74 g/mol. Its IUPAC name is (2R,5R)-5-[[(2S)-1-amino-1-oxo-6-[[4-(propylamino)benzoyl]amino]hexan-2-yl]carbamoyl]-2-(methylamino)-3-oxohexane-1,6-disulfonic acid.
| Compound Name | (2R,5R)-5-[[(2S)-1-amino-1-oxo-6-[[4-(propylamino)benzoyl]amino]hexan-2-yl]carbamoyl]-2-(methylamino)-3-oxohexane-1,6-disulfonic acid |
|---|---|
| PubChem CID | 157359366 |
| Molecular Formula | C24H39N5O10S2 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | (2R,5R)-5-[[(2S)-1-amino-1-oxo-6-[[4-(propylamino)benzoyl]amino]hexan-2-yl]carbamoyl]-2-(methylamino)-3-oxohexane-1,6-disulfonic acid |
| SMILES | CCCNc1ccc(C(=O)NCCCC[C@H](NC(=O)[C@@H](CC(=O)[C@H](CS(=O)(=O)O)NC)CS(=O)(=O)O)C(N)=O)cc1 |
| InChI | InChI=1S/C24H39N5O10S2/c1-3-11-27-18-9-7-16(8-10-18)23(32)28-12-5-4-6-19(22(25)31)29-24(33)17(14-40(34,35)36)13-21(30)20(26-2)15-41(37,38)39/h7-10,17,19-20,26-27H,3-6,11-15H2,1-2H3,(H2,25,31)(H,28,32)(H,29,33)(H,34,35,36)(H,37,38,39)/t17-,19-,20-/m0/s1 |
| InChIKey | MKPVIVPBJINJMB-IHPCNDPISA-N |
| XLogP | -0.68 |
| TPSA | 251.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|