C26H40N4O12S2 — CID 158254629
5-[[(2R,5R)-5-[[[(2S)-1-amino-6-[(4-methylbenzoyl)amino]-1-oxohexan-2-yl]amino]methyl]-3-oxo-1,6-disulfohexan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 158254629) has the molecular formula C26H40N4O12S2 and a molecular weight of 664.76 g/mol. Its IUPAC name is 5-[[(2R,5R)-5-[[[(2S)-1-amino-6-[(4-methylbenzoyl)amino]-1-oxohexan-2-yl]amino]methyl]-3-oxo-1,6-disulfohexan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(2R,5R)-5-[[[(2S)-1-amino-6-[(4-methylbenzoyl)amino]-1-oxohexan-2-yl]amino]methyl]-3-oxo-1,6-disulfohexan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 158254629 |
| Molecular Formula | C26H40N4O12S2 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.21 |
| IUPAC Name | 5-[[(2R,5R)-5-[[[(2S)-1-amino-6-[(4-methylbenzoyl)amino]-1-oxohexan-2-yl]amino]methyl]-3-oxo-1,6-disulfohexan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(C(=O)NCCCC[C@H](NC[C@@H](CC(=O)[C@H](CS(=O)(=O)O)NC(=O)CCCC(=O)O)CS(=O)(=O)O)C(N)=O)cc1 |
| InChI | InChI=1S/C26H40N4O12S2/c1-17-8-10-19(11-9-17)26(36)28-12-3-2-5-20(25(27)35)29-14-18(15-43(37,38)39)13-22(31)21(16-44(40,41)42)30-23(32)6-4-7-24(33)34/h8-11,18,20-21,29H,2-7,12-16H2,1H3,(H2,27,35)(H,28,36)(H,30,32)(H,33,34)(H,37,38,39)(H,40,41,42)/t18-,20+,21+/m1/s1 |
| InChIKey | GHCZYWGDFRGEBX-GIVPXCGWSA-N |
| XLogP | -0.57 |
| TPSA | 276.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|