C30H47N3O9 — CID 162051218
N-[6-amino-6-oxo-5-[[2-[2-[4-oxo-5-[2-(4-oxopentoxy)ethoxy]pentoxy]ethoxy]acetyl]amino]hexyl]-4-methylbenzamide (PubChem CID 162051218) has the molecular formula C30H47N3O9 and a molecular weight of 593.72 g/mol. Its IUPAC name is N-[6-amino-6-oxo-5-[[2-[2-[4-oxo-5-[2-(4-oxopentoxy)ethoxy]pentoxy]ethoxy]acetyl]amino]hexyl]-4-methylbenzamide.
| Compound Name | N-[6-amino-6-oxo-5-[[2-[2-[4-oxo-5-[2-(4-oxopentoxy)ethoxy]pentoxy]ethoxy]acetyl]amino]hexyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 162051218 |
| Molecular Formula | C30H47N3O9 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | N-[6-amino-6-oxo-5-[[2-[2-[4-oxo-5-[2-(4-oxopentoxy)ethoxy]pentoxy]ethoxy]acetyl]amino]hexyl]-4-methylbenzamide |
| SMILES | CC(=O)CCCOCCOCC(=O)CCCOCCOCC(=O)NC(CCCCNC(=O)c1ccc(C)cc1)C(N)=O |
| InChI | InChI=1S/C30H47N3O9/c1-23-10-12-25(13-11-23)30(38)32-14-4-3-9-27(29(31)37)33-28(36)22-42-20-18-40-16-6-8-26(35)21-41-19-17-39-15-5-7-24(2)34/h10-13,27H,3-9,14-22H2,1-2H3,(H2,31,37)(H,32,38)(H,33,36) |
| InChIKey | GIHLFCRTXOJGFH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 172.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|