C51H65N3O10 — CID 159510512
6-[[3-[4-(2-methylbutan-2-yl)phenoxy]benzoyl]amino]-2-[[2-[2-[5-[[3-[4-(2-methylbutan-2-yl)phenoxy]benzoyl]amino]-4-oxopentoxy]ethoxy]acetyl]amino]hexanoic acid (PubChem CID 159510512) has the molecular formula C51H65N3O10 and a molecular weight of 880.09 g/mol. Its IUPAC name is 6-[[3-[4-(2-methylbutan-2-yl)phenoxy]benzoyl]amino]-2-[[2-[2-[5-[[3-[4-(2-methylbutan-2-yl)phenoxy]benzoyl]amino]-4-oxopentoxy]ethoxy]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[3-[4-(2-methylbutan-2-yl)phenoxy]benzoyl]amino]-2-[[2-[2-[5-[[3-[4-(2-methylbutan-2-yl)phenoxy]benzoyl]amino]-4-oxopentoxy]ethoxy]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 159510512 |
| Molecular Formula | C51H65N3O10 |
| Molecular Weight | 880.09 g/mol |
| Exact Mass | 879.47 |
| IUPAC Name | 6-[[3-[4-(2-methylbutan-2-yl)phenoxy]benzoyl]amino]-2-[[2-[2-[5-[[3-[4-(2-methylbutan-2-yl)phenoxy]benzoyl]amino]-4-oxopentoxy]ethoxy]acetyl]amino]hexanoic acid |
| SMILES | CCC(C)(C)c1ccc(Oc2cccc(C(=O)NCCCCC(NC(=O)COCCOCCCC(=O)CNC(=O)c3cccc(Oc4ccc(C(C)(C)CC)cc4)c3)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C51H65N3O10/c1-7-50(3,4)38-20-24-41(25-21-38)63-43-17-11-14-36(32-43)47(57)52-28-10-9-19-45(49(59)60)54-46(56)35-62-31-30-61-29-13-16-40(55)34-53-48(58)37-15-12-18-44(33-37)64-42-26-22-39(23-27-42)51(5,6)8-2/h11-12,14-15,17-18,20-27,32-33,45H,7-10,13,16,19,28-31,34-35H2,1-6H3,(H,52,57)(H,53,58)(H,54,56)(H,59,60) |
| InChIKey | BZTFRHJMMNDNMK-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.09 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|